C23H35N5O8 — CID 155464955
4,7,10-tris(carboxymethyl)-2-[[4-(methylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1-carboxylic acid (PubChem CID 155464955) has the molecular formula C23H35N5O8 and a molecular weight of 509.56 g/mol. Its IUPAC name is 4,7,10-tris(carboxymethyl)-2-[[4-(methylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1-carboxylic acid.
| Compound Name | 4,7,10-tris(carboxymethyl)-2-[[4-(methylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1-carboxylic acid |
|---|---|
| PubChem CID | 155464955 |
| Molecular Formula | C23H35N5O8 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 4,7,10-tris(carboxymethyl)-2-[[4-(methylamino)phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1-carboxylic acid |
| SMILES | CNc1ccc(CC2CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN2C(=O)O)cc1 |
| InChI | InChI=1S/C23H35N5O8/c1-24-18-4-2-17(3-5-18)12-19-13-27(16-22(33)34)9-8-25(14-20(29)30)6-7-26(15-21(31)32)10-11-28(19)23(35)36/h2-5,19,24H,6-16H2,1H3,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | KBFLJCAEWYRYAI-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |