C10H13N3O5 — CID 15546603
4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]butanoic acid (PubChem CID 15546603) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]butanoic acid.
| Compound Name | 4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]butanoic acid |
|---|---|
| PubChem CID | 15546603 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]butanoic acid |
| SMILES | C/C(=N\CCCC(=O)O)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C10H13N3O5/c1-5(11-4-2-3-6(14)15)7-8(16)12-10(18)13-9(7)17/h7H,2-4H2,1H3,(H,14,15)(H2,12,13,16,17,18)/b11-5+ |
| InChIKey | KHGYTXJOKKCNTA-VZUCSPMQSA-N |
| XLogP | -0.71 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|