C12H17N3O5 — CID 15546604
6-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]hexanoic acid (PubChem CID 15546604) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 6-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]hexanoic acid.
| Compound Name | 6-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]hexanoic acid |
|---|---|
| PubChem CID | 15546604 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 6-[1-(2,4,6-trioxo-1,3-diazinan-5-yl)ethylideneamino]hexanoic acid |
| SMILES | C/C(=N\CCCCCC(=O)O)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H17N3O5/c1-7(13-6-4-2-3-5-8(16)17)9-10(18)14-12(20)15-11(9)19/h9H,2-6H2,1H3,(H,16,17)(H2,14,15,18,19,20)/b13-7+ |
| InChIKey | APOUKPZCCICJPS-NTUHNPAUSA-N |
| XLogP | 0.07 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|