C41H43N — CID 155466839
N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine (PubChem CID 155466839) has the molecular formula C41H43N and a molecular weight of 549.80 g/mol. Its IUPAC name is N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine.
| Compound Name | N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 155466839 |
| Molecular Formula | C41H43N |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | N-[4-(3,5-ditert-butylphenyl)phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2ccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C41H43N/c1-39(2,3)30-24-29(25-31(26-30)40(4,5)6)28-18-20-33(21-19-28)42(32-14-10-9-11-15-32)34-22-23-36-35-16-12-13-17-37(35)41(7,8)38(36)27-34/h9-27H,1-8H3 |
| InChIKey | PBHSKSDBZMSHJB-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |