C63H67N — CID 155467421
N-[4-(3-cyclohexylphenyl)phenyl]-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-9,9-dimethylfluoren-2-amine (PubChem CID 155467421) has the molecular formula C63H67N and a molecular weight of 838.24 g/mol. Its IUPAC name is N-[4-(3-cyclohexylphenyl)phenyl]-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-9,9-dimethylfluoren-2-amine.
| Compound Name | N-[4-(3-cyclohexylphenyl)phenyl]-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 155467421 |
| Molecular Formula | C63H67N |
| Molecular Weight | 838.24 g/mol |
| Exact Mass | 837.53 |
| IUPAC Name | N-[4-(3-cyclohexylphenyl)phenyl]-N-[4-[3-(3,5-ditert-butylphenyl)phenyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-9,9-dimethylfluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2cccc(-c3ccc(N(c4ccc(-c5cccc(C6CCCCC6)c5)cc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4c3CCCC4)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C63H67N/c1-61(2,3)49-38-48(39-50(40-49)62(4,5)6)46-22-17-23-47(37-46)53-34-35-60(57-26-13-12-24-54(53)57)64(52-32-33-56-55-25-14-15-27-58(55)63(7,8)59(56)41-52)51-30-28-43(29-31-51)45-21-16-20-44(36-45)42-18-10-9-11-19-42/h14-17,20-23,25,27-42H,9-13,18-19,24,26H2,1-8H3 |
| InChIKey | LBSWMBDKXHLJRT-UHFFFAOYSA-N |
| XLogP | 17.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.24 |
| LogP ≤ 5 | 17.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |