About 7-tert-butyl-2,1,3-benzoxadiazol-4-amine
7-tert-butyl-2,1,3-benzoxadiazol-4-amine (PubChem CID 155467850) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 7-tert-butyl-2,1,3-benzoxadiazol-4-amine.
Molecular Properties
| Compound Name | 7-tert-butyl-2,1,3-benzoxadiazol-4-amine |
| PubChem CID | 155467850 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 7-tert-butyl-2,1,3-benzoxadiazol-4-amine |
| SMILES | CC(C)(C)c1ccc(N)c2nonc12 |
| InChI | InChI=1S/C10H13N3O/c1-10(2,3)6-4-5-7(11)9-8(6)12-14-13-9/h4-5H,11H2,1-3H3 |
| InChIKey | TWAYPABTJLLWCH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butyl-2,1,3-benzoxadiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-2,1,3-benzoxadiazol-4-amine?
The IUPAC name of 7-tert-butyl-2,1,3-benzoxadiazol-4-amine (CID 155467850) is 7-tert-butyl-2,1,3-benzoxadiazol-4-amine.
What is the SMILES notation for 7-tert-butyl-2,1,3-benzoxadiazol-4-amine?
The canonical SMILES for 7-tert-butyl-2,1,3-benzoxadiazol-4-amine is CC(C)(C)c1ccc(N)c2nonc12.
What is the InChIKey of 7-tert-butyl-2,1,3-benzoxadiazol-4-amine?
The InChIKey is TWAYPABTJLLWCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-10(2,3)6-4-5-7(11)9-8(6)12-14-13-9/h4-5H,11H2,1-3H3.
What are the key properties of 7-tert-butyl-2,1,3-benzoxadiazol-4-amine?
7-tert-butyl-2,1,3-benzoxadiazol-4-amine has a molecular weight of 191.23 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-2,1,3-benzoxadiazol-4-amine is sourced from PubChem (CID 155467850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).