About 3,6-diiodo-2,4-dimethylpyridine
3,6-diiodo-2,4-dimethylpyridine (PubChem CID 155467914) has the molecular formula C7H7I2N
and a molecular weight of 358.95 g/mol. Its IUPAC name is 3,6-diiodo-2,4-dimethylpyridine.
Molecular Properties
| Compound Name | 3,6-diiodo-2,4-dimethylpyridine |
| PubChem CID | 155467914 |
| Molecular Formula | C7H7I2N |
| Molecular Weight | 358.95 g/mol |
| Exact Mass | 358.87 |
| IUPAC Name | 3,6-diiodo-2,4-dimethylpyridine |
| SMILES | Cc1cc(I)nc(C)c1I |
| InChI | InChI=1S/C7H7I2N/c1-4-3-6(8)10-5(2)7(4)9/h3H,1-2H3 |
| InChIKey | VXYJSUSSRCFAAF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diiodo-2,4-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diiodo-2,4-dimethylpyridine?
The IUPAC name of 3,6-diiodo-2,4-dimethylpyridine (CID 155467914) is 3,6-diiodo-2,4-dimethylpyridine.
What is the SMILES notation for 3,6-diiodo-2,4-dimethylpyridine?
The canonical SMILES for 3,6-diiodo-2,4-dimethylpyridine is Cc1cc(I)nc(C)c1I.
What is the InChIKey of 3,6-diiodo-2,4-dimethylpyridine?
The InChIKey is VXYJSUSSRCFAAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7I2N/c1-4-3-6(8)10-5(2)7(4)9/h3H,1-2H3.
What are the key properties of 3,6-diiodo-2,4-dimethylpyridine?
3,6-diiodo-2,4-dimethylpyridine has a molecular weight of 358.95 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diiodo-2,4-dimethylpyridine is sourced from PubChem (CID 155467914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).