C13H17F3O — CID 155467976
(2E,4Z,6E)-4-ethenyl-6-ethyl-1,1,1-trifluoro-7-methoxyocta-2,4,6-triene (PubChem CID 155467976) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is (2E,4Z,6E)-4-ethenyl-6-ethyl-1,1,1-trifluoro-7-methoxyocta-2,4,6-triene.
| Compound Name | (2E,4Z,6E)-4-ethenyl-6-ethyl-1,1,1-trifluoro-7-methoxyocta-2,4,6-triene |
|---|---|
| PubChem CID | 155467976 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2E,4Z,6E)-4-ethenyl-6-ethyl-1,1,1-trifluoro-7-methoxyocta-2,4,6-triene |
| SMILES | C=CC(=C/C(CC)=C(\C)OC)/C=C/C(F)(F)F |
| InChI | InChI=1S/C13H17F3O/c1-5-11(7-8-13(14,15)16)9-12(6-2)10(3)17-4/h5,7-9H,1,6H2,2-4H3/b8-7+,11-9-,12-10+ |
| InChIKey | ZGRPAFKOABWIEH-OWKRJACHSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|