C15H30F3NO2S — CID 155468035
N-butan-2-yl-3,5-diethyl-4,4,5-trifluoroheptane-3-sulfonamide (PubChem CID 155468035) has the molecular formula C15H30F3NO2S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-butan-2-yl-3,5-diethyl-4,4,5-trifluoroheptane-3-sulfonamide.
| Compound Name | N-butan-2-yl-3,5-diethyl-4,4,5-trifluoroheptane-3-sulfonamide |
|---|---|
| PubChem CID | 155468035 |
| Molecular Formula | C15H30F3NO2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-butan-2-yl-3,5-diethyl-4,4,5-trifluoroheptane-3-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)C(CC)(CC)C(F)(F)C(F)(CC)CC |
| InChI | InChI=1S/C15H30F3NO2S/c1-7-12(6)19-22(20,21)14(10-4,11-5)15(17,18)13(16,8-2)9-3/h12,19H,7-11H2,1-6H3 |
| InChIKey | SVWIGDRHQSCZCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |