C7H8BrClN4 — CID 155468247
N,N'-diamino-N-(2-bromo-4-chlorophenyl)methanimidamide (PubChem CID 155468247) has the molecular formula C7H8BrClN4 and a molecular weight of 263.53 g/mol. Its IUPAC name is N,N'-diamino-N-(2-bromo-4-chlorophenyl)methanimidamide.
| Compound Name | N,N'-diamino-N-(2-bromo-4-chlorophenyl)methanimidamide |
|---|---|
| PubChem CID | 155468247 |
| Molecular Formula | C7H8BrClN4 |
| Molecular Weight | 263.53 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | N,N'-diamino-N-(2-bromo-4-chlorophenyl)methanimidamide |
| SMILES | N/N=C\N(N)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C7H8BrClN4/c8-6-3-5(9)1-2-7(6)13(11)4-12-10/h1-4H,10-11H2/b12-4- |
| InChIKey | IDZRDRHXQDIQNN-QCDXTXTGSA-N |
| XLogP | 1.68 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|