C28H42N2O2 — CID 155468615
(1S,2R)-2-[10-[(2R)-1-amino-3-phenylpropan-2-yl]oxydecoxy]-2,3-dihydro-1H-inden-1-amine (PubChem CID 155468615) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is (1S,2R)-2-[10-[(2R)-1-amino-3-phenylpropan-2-yl]oxydecoxy]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2R)-2-[10-[(2R)-1-amino-3-phenylpropan-2-yl]oxydecoxy]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 155468615 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (1S,2R)-2-[10-[(2R)-1-amino-3-phenylpropan-2-yl]oxydecoxy]-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC[C@@H](Cc1ccccc1)OCCCCCCCCCCO[C@@H]1Cc2ccccc2[C@@H]1N |
| InChI | InChI=1S/C28H42N2O2/c29-22-25(20-23-14-8-7-9-15-23)31-18-12-5-3-1-2-4-6-13-19-32-27-21-24-16-10-11-17-26(24)28(27)30/h7-11,14-17,25,27-28H,1-6,12-13,18-22,29-30H2/t25-,27-,28+/m1/s1 |
| InChIKey | MVPMYXKYQUKKPG-KZQOYIJHSA-N |
| XLogP | 5.34 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|