About 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole
6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole (PubChem CID 155468939) has the molecular formula C14H20FN3
and a molecular weight of 249.33 g/mol. Its IUPAC name is 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole.
Molecular Properties
| Compound Name | 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole |
| PubChem CID | 155468939 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole |
| SMILES | CN1CCC(C2(C)C=c3[nH]ncc3=CC2)C(F)C1 |
| InChI | InChI=1S/C14H20FN3/c1-14(11-4-6-18(2)9-12(11)15)5-3-10-8-16-17-13(10)7-14/h3,7-8,11-12,17H,4-6,9H2,1-2H3 |
| InChIKey | UBJPSDGXQIUMOD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole?
The IUPAC name of 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole (CID 155468939) is 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole.
What is the SMILES notation for 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole?
The canonical SMILES for 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole is CN1CCC(C2(C)C=c3[nH]ncc3=CC2)C(F)C1.
What is the InChIKey of 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole?
The InChIKey is UBJPSDGXQIUMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FN3/c1-14(11-4-6-18(2)9-12(11)15)5-3-10-8-16-17-13(10)7-14/h3,7-8,11-12,17H,4-6,9H2,1-2H3.
What are the key properties of 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole?
6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole has a molecular weight of 249.33 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-fluoro-1-methylpiperidin-4-yl)-6-methyl-1,5-dihydroindazole is sourced from PubChem (CID 155468939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).