C16H21ClN2O — CID 155469053
[5-chloro-2-methyl-4-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]methanimine (PubChem CID 155469053) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is [5-chloro-2-methyl-4-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]methanimine.
| Compound Name | [5-chloro-2-methyl-4-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]methanimine |
|---|---|
| PubChem CID | 155469053 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [5-chloro-2-methyl-4-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]methanimine |
| SMILES | [H]/N=C/c1cc(Cl)c(C2CCN(C3COC3)CC2)cc1C |
| InChI | InChI=1S/C16H21ClN2O/c1-11-6-15(16(17)7-13(11)8-18)12-2-4-19(5-3-12)14-9-20-10-14/h6-8,12,14,18H,2-5,9-10H2,1H3/b18-8+ |
| InChIKey | KBEGAHLIBQJGNG-QGMBQPNBSA-N |
| XLogP | 3.22 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|