C55H42N2O2 — CID 155469214
[4-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(9-phenylcarbazol-3-yl)anilino]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 155469214) has the molecular formula C55H42N2O2 and a molecular weight of 762.95 g/mol. Its IUPAC name is [4-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(9-phenylcarbazol-3-yl)anilino]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(9-phenylcarbazol-3-yl)anilino]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155469214 |
| Molecular Formula | C55H42N2O2 |
| Molecular Weight | 762.95 g/mol |
| Exact Mass | 762.32 |
| IUPAC Name | [4-[4-[N-(9,9-dimethylfluoren-2-yl)-4-(9-phenylcarbazol-3-yl)anilino]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(N(c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)cc1 |
| InChI | InChI=1S/C55H42N2O2/c1-36(2)54(58)59-45-30-22-38(23-31-45)37-18-25-42(26-19-37)56(44-29-32-47-46-14-8-10-16-50(46)55(3,4)51(47)35-44)43-27-20-39(21-28-43)40-24-33-53-49(34-40)48-15-9-11-17-52(48)57(53)41-12-6-5-7-13-41/h5-35H,1H2,2-4H3 |
| InChIKey | VWQHCXDBGDQHEO-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.95 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|