C25H25Cl3N6O6 — CID 155469765
2,2,2-trichloroethyl 4-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 155469765) has the molecular formula C25H25Cl3N6O6 and a molecular weight of 611.87 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155469765 |
| Molecular Formula | C25H25Cl3N6O6 |
| Molecular Weight | 611.87 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | 2,2,2-trichloroethyl 4-[4-[[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]methyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCc4cnn(C5CCN(C(=O)OCC(Cl)(Cl)Cl)CC5)c4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25Cl3N6O6/c26-25(27,28)13-40-24(39)32-8-6-15(7-9-32)33-12-14(11-30-33)10-29-17-3-1-2-16-20(17)23(38)34(22(16)37)18-4-5-19(35)31-21(18)36/h1-3,11-12,15,18,29H,4-10,13H2,(H,31,35,36) |
| InChIKey | SNNHNKPZZQLPSZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|