C13H22FNO5 — CID 155469996
(2S,3R)-2-(carbonofluoridoylamino)-3-[(2R)-5,5,6,6-tetramethyl-1,4-dioxan-2-yl]butanoic acid (PubChem CID 155469996) has the molecular formula C13H22FNO5 and a molecular weight of 291.32 g/mol. Its IUPAC name is (2S,3R)-2-(carbonofluoridoylamino)-3-[(2R)-5,5,6,6-tetramethyl-1,4-dioxan-2-yl]butanoic acid.
| Compound Name | (2S,3R)-2-(carbonofluoridoylamino)-3-[(2R)-5,5,6,6-tetramethyl-1,4-dioxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 155469996 |
| Molecular Formula | C13H22FNO5 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (2S,3R)-2-(carbonofluoridoylamino)-3-[(2R)-5,5,6,6-tetramethyl-1,4-dioxan-2-yl]butanoic acid |
| SMILES | C[C@@H]([C@@H]1COC(C)(C)C(C)(C)O1)[C@H](NC(=O)F)C(=O)O |
| InChI | InChI=1S/C13H22FNO5/c1-7(9(10(16)17)15-11(14)18)8-6-19-12(2,3)13(4,5)20-8/h7-9H,6H2,1-5H3,(H,15,18)(H,16,17)/t7-,8-,9-/m0/s1 |
| InChIKey | SPJFOMDQBWRGAV-CIUDSAMLSA-N |
| XLogP | 1.73 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|