About (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine
(2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine (PubChem CID 155470121) has the molecular formula C8H14ClNO
and a molecular weight of 175.66 g/mol. Its IUPAC name is (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine |
| PubChem CID | 155470121 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine |
| SMILES | CNC(/C=C(\C)Cl)=C(/C)OC |
| InChI | InChI=1S/C8H14ClNO/c1-6(9)5-8(10-3)7(2)11-4/h5,10H,1-4H3/b6-5+,8-7- |
| InChIKey | OIOGYJVENYHBBK-MDAAKZFYSA-N |
| XLogP | 2.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine?
The IUPAC name of (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine (CID 155470121) is (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine.
What is the SMILES notation for (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine?
The canonical SMILES for (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine is CNC(/C=C(\C)Cl)=C(/C)OC.
What is the InChIKey of (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine?
The InChIKey is OIOGYJVENYHBBK-MDAAKZFYSA-N. The full InChI is InChI=1S/C8H14ClNO/c1-6(9)5-8(10-3)7(2)11-4/h5,10H,1-4H3/b6-5+,8-7-.
What are the key properties of (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine?
(2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine has a molecular weight of 175.66 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-5-chloro-2-methoxy-N-methylhexa-2,4-dien-3-amine is sourced from PubChem (CID 155470121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).