About (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene
(6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene (PubChem CID 155470349) has the molecular formula C10H15F3O
and a molecular weight of 208.22 g/mol. Its IUPAC name is (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene.
Molecular Properties
| Compound Name | (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene |
| PubChem CID | 155470349 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene |
| SMILES | C=CC(CC/C=C(\C)OC)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O/c1-4-9(10(11,12)13)7-5-6-8(2)14-3/h4,6,9H,1,5,7H2,2-3H3/b8-6+ |
| InChIKey | TWWXXYUXDJIFQJ-SOFGYWHQSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene?
The IUPAC name of (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene (CID 155470349) is (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene.
What is the SMILES notation for (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene?
The canonical SMILES for (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene is C=CC(CC/C=C(\C)OC)C(F)(F)F.
What is the InChIKey of (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene?
The InChIKey is TWWXXYUXDJIFQJ-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H15F3O/c1-4-9(10(11,12)13)7-5-6-8(2)14-3/h4,6,9H,1,5,7H2,2-3H3/b8-6+.
What are the key properties of (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene?
(6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene has a molecular weight of 208.22 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-7-methoxy-3-(trifluoromethyl)octa-1,6-diene is sourced from PubChem (CID 155470349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).