C44H38N4O — CID 155470656
2,2-dimethylpropanimidoyl 5-[3-[4-(2,6-diphenyl-1,6-dihydropyrimidin-4-yl)phenyl]phenyl]naphthalene-1-carboximidate (PubChem CID 155470656) has the molecular formula C44H38N4O and a molecular weight of 638.82 g/mol. Its IUPAC name is 2,2-dimethylpropanimidoyl 5-[3-[4-(2,6-diphenyl-1,6-dihydropyrimidin-4-yl)phenyl]phenyl]naphthalene-1-carboximidate.
| Compound Name | 2,2-dimethylpropanimidoyl 5-[3-[4-(2,6-diphenyl-1,6-dihydropyrimidin-4-yl)phenyl]phenyl]naphthalene-1-carboximidate |
|---|---|
| PubChem CID | 155470656 |
| Molecular Formula | C44H38N4O |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.30 |
| IUPAC Name | 2,2-dimethylpropanimidoyl 5-[3-[4-(2,6-diphenyl-1,6-dihydropyrimidin-4-yl)phenyl]phenyl]naphthalene-1-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])C(C)(C)C)c1cccc2c(-c3cccc(-c4ccc(C5=CC(c6ccccc6)NC(c6ccccc6)=N5)cc4)c3)cccc12 |
| InChI | InChI=1S/C44H38N4O/c1-44(2,3)43(46)49-41(45)38-22-12-20-36-35(19-11-21-37(36)38)34-18-10-17-33(27-34)29-23-25-31(26-24-29)40-28-39(30-13-6-4-7-14-30)47-42(48-40)32-15-8-5-9-16-32/h4-28,39,45-46H,1-3H3,(H,47,48)/b45-41-,46-43+ |
| InChIKey | ONANFPLFJUAYNN-LRUJCANYSA-N |
| XLogP | 10.67 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|