C14H21F3N2 — CID 155471401
N-[(E)-3-(1,1,1-trifluorobut-3-en-2-ylideneamino)pent-2-en-2-yl]cyclopentanamine (PubChem CID 155471401) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is N-[(E)-3-(1,1,1-trifluorobut-3-en-2-ylideneamino)pent-2-en-2-yl]cyclopentanamine.
| Compound Name | N-[(E)-3-(1,1,1-trifluorobut-3-en-2-ylideneamino)pent-2-en-2-yl]cyclopentanamine |
|---|---|
| PubChem CID | 155471401 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(E)-3-(1,1,1-trifluorobut-3-en-2-ylideneamino)pent-2-en-2-yl]cyclopentanamine |
| SMILES | C=C/C(=N\C(CC)=C(/C)NC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2/c1-4-12(19-13(5-2)14(15,16)17)10(3)18-11-8-6-7-9-11/h5,11,18H,2,4,6-9H2,1,3H3/b12-10+,19-13+ |
| InChIKey | PXTZYCNGJZJNMA-DHJSAQKKSA-N |
| XLogP | 4.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|