C24H30FN5O — CID 155471575
(E)-N-[(E)-ethylideneamino]-5-[5-fluoro-2-[3-(methylaminomethyl)imidazo[1,2-a]pyridin-6-yl]phenoxy]-N,3-dimethylpent-2-en-2-amine (PubChem CID 155471575) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is (E)-N-[(E)-ethylideneamino]-5-[5-fluoro-2-[3-(methylaminomethyl)imidazo[1,2-a]pyridin-6-yl]phenoxy]-N,3-dimethylpent-2-en-2-amine.
| Compound Name | (E)-N-[(E)-ethylideneamino]-5-[5-fluoro-2-[3-(methylaminomethyl)imidazo[1,2-a]pyridin-6-yl]phenoxy]-N,3-dimethylpent-2-en-2-amine |
|---|---|
| PubChem CID | 155471575 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (E)-N-[(E)-ethylideneamino]-5-[5-fluoro-2-[3-(methylaminomethyl)imidazo[1,2-a]pyridin-6-yl]phenoxy]-N,3-dimethylpent-2-en-2-amine |
| SMILES | C/C=N/N(C)/C(C)=C(\C)CCOc1cc(F)ccc1-c1ccc2ncc(CNC)n2c1 |
| InChI | InChI=1S/C24H30FN5O/c1-6-28-29(5)18(3)17(2)11-12-31-23-13-20(25)8-9-22(23)19-7-10-24-27-15-21(14-26-4)30(24)16-19/h6-10,13,15-16,26H,11-12,14H2,1-5H3/b18-17+,28-6+ |
| InChIKey | COOGFNBYUCTTDD-JRGKCWCFSA-N |
| XLogP | 4.86 |
| TPSA | 54.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|