C25H36O7 — CID 155471697
dimethyl 2-[6,8-dibutyl-3-(2-methoxy-2-oxoethyl)-3,4-dihydro-2H-chromen-4-yl]propanedioate (PubChem CID 155471697) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is dimethyl 2-[6,8-dibutyl-3-(2-methoxy-2-oxoethyl)-3,4-dihydro-2H-chromen-4-yl]propanedioate.
| Compound Name | dimethyl 2-[6,8-dibutyl-3-(2-methoxy-2-oxoethyl)-3,4-dihydro-2H-chromen-4-yl]propanedioate |
|---|---|
| PubChem CID | 155471697 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | dimethyl 2-[6,8-dibutyl-3-(2-methoxy-2-oxoethyl)-3,4-dihydro-2H-chromen-4-yl]propanedioate |
| SMILES | CCCCc1cc(CCCC)c2c(c1)C(C(C(=O)OC)C(=O)OC)C(CC(=O)OC)CO2 |
| InChI | InChI=1S/C25H36O7/c1-6-8-10-16-12-17(11-9-7-2)23-19(13-16)21(18(15-32-23)14-20(26)29-3)22(24(27)30-4)25(28)31-5/h12-13,18,21-22H,6-11,14-15H2,1-5H3 |
| InChIKey | JBBRQBLKCPTTLW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|