C40H30N4O3 — CID 155471707
2-(4-cyclohexa-1,5-dien-1-ylphenyl)-5-[4-[4-[5-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]phenyl]-1,3,4-oxadiazole (PubChem CID 155471707) has the molecular formula C40H30N4O3 and a molecular weight of 614.71 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-5-[4-[4-[5-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-5-[4-[4-[5-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155471707 |
| Molecular Formula | C40H30N4O3 |
| Molecular Weight | 614.71 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylphenyl)-5-[4-[4-[5-(4-cyclohexa-1,5-dien-1-ylphenyl)-1,3,4-oxadiazol-2-yl]phenoxy]phenyl]-1,3,4-oxadiazole |
| SMILES | C1=CC(c2ccc(-c3nnc(-c4ccc(Oc5ccc(-c6nnc(-c7ccc(C8=CCCC=C8)cc7)o6)cc5)cc4)o3)cc2)=CCC1 |
| InChI | InChI=1S/C40H30N4O3/c1-3-7-27(8-4-1)29-11-15-31(16-12-29)37-41-43-39(46-37)33-19-23-35(24-20-33)45-36-25-21-34(22-26-36)40-44-42-38(47-40)32-17-13-30(14-18-32)28-9-5-2-6-10-28/h3,5,7-26H,1-2,4,6H2 |
| InChIKey | RQNAWLGSOIVSED-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.71 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |