About N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine
N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine (PubChem CID 155471975) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine.
Molecular Properties
| Compound Name | N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine |
| PubChem CID | 155471975 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine |
| SMILES | CNCC(C)=C=CCSC |
| InChI | InChI=1S/C8H15NS/c1-8(7-9-2)5-4-6-10-3/h4,9H,6-7H2,1-3H3 |
| InChIKey | MJMZDYJQVHZISH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine?
The IUPAC name of N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine (CID 155471975) is N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine.
What is the SMILES notation for N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine?
The canonical SMILES for N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine is CNCC(C)=C=CCSC.
What is the InChIKey of N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine?
The InChIKey is MJMZDYJQVHZISH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-8(7-9-2)5-4-6-10-3/h4,9H,6-7H2,1-3H3.
What are the key properties of N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine?
N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine has a molecular weight of 157.28 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-5-methylsulfanylpenta-2,3-dien-1-amine is sourced from PubChem (CID 155471975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).