C14H24NO+ — CID 155471992
2-[(3E,4Z)-3-ethylidenehepta-1,4,6-trien-2-yl]oxyethyl-trimethylazanium (PubChem CID 155471992) has the molecular formula C14H24NO+ and a molecular weight of 222.35 g/mol. Its IUPAC name is 2-[(3E,4Z)-3-ethylidenehepta-1,4,6-trien-2-yl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(3E,4Z)-3-ethylidenehepta-1,4,6-trien-2-yl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 155471992 |
| Molecular Formula | C14H24NO+ |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | 2-[(3E,4Z)-3-ethylidenehepta-1,4,6-trien-2-yl]oxyethyl-trimethylazanium |
| SMILES | C=C/C=C\C(=C/C)C(=C)OCC[N+](C)(C)C |
| InChI | InChI=1S/C14H24NO/c1-7-9-10-14(8-2)13(3)16-12-11-15(4,5)6/h7-10H,1,3,11-12H2,2,4-6H3/q+1/b10-9-,14-8+ |
| InChIKey | CJECWCCWMQKRKC-SIWKXLNPSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|