C17H12N2O2 — CID 155472259
9-prop-2-enyl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-2,16-dione (PubChem CID 155472259) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 9-prop-2-enyl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-2,16-dione.
| Compound Name | 9-prop-2-enyl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-2,16-dione |
|---|---|
| PubChem CID | 155472259 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 9-prop-2-enyl-9,15-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1(10),3,5,7,11,13-hexaene-2,16-dione |
| SMILES | C=CCn1c2c(c(=O)c3ccccc31)C(=O)n1cccc1-2 |
| InChI | InChI=1S/C17H12N2O2/c1-2-9-18-12-7-4-3-6-11(12)16(20)14-15(18)13-8-5-10-19(13)17(14)21/h2-8,10H,1,9H2 |
| InChIKey | XOWYCRGJAHKXRE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|