C9H17IN2O — CID 155472504
3-[(3aR,6aS)-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-ol (PubChem CID 155472504) has the molecular formula C9H17IN2O and a molecular weight of 296.15 g/mol. Its IUPAC name is 3-[(3aR,6aS)-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-ol.
| Compound Name | 3-[(3aR,6aS)-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 155472504 |
| Molecular Formula | C9H17IN2O |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-[(3aR,6aS)-5-iodo-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propan-1-ol |
| SMILES | OCCCN1C[C@H]2CN(I)C[C@H]2C1 |
| InChI | InChI=1S/C9H17IN2O/c10-12-6-8-4-11(2-1-3-13)5-9(8)7-12/h8-9,13H,1-7H2/t8-,9+ |
| InChIKey | RJGKYQVNDZGRKC-DTORHVGOSA-N |
| XLogP | 0.58 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|