About (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine
(1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine (PubChem CID 155472573) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine.
Molecular Properties
| Compound Name | (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine |
| PubChem CID | 155472573 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine |
| SMILES | CCC(C)C1C(C)(C)[C@]1(C)N |
| InChI | InChI=1S/C10H21N/c1-6-7(2)8-9(3,4)10(8,5)11/h7-8H,6,11H2,1-5H3/t7?,8?,10-/m1/s1 |
| InChIKey | KPPPZINSVLWXQN-SFVIPPHHSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine?
The IUPAC name of (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine (CID 155472573) is (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine.
What is the SMILES notation for (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine?
The canonical SMILES for (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine is CCC(C)C1C(C)(C)[C@]1(C)N.
What is the InChIKey of (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine?
The InChIKey is KPPPZINSVLWXQN-SFVIPPHHSA-N. The full InChI is InChI=1S/C10H21N/c1-6-7(2)8-9(3,4)10(8,5)11/h7-8H,6,11H2,1-5H3/t7?,8?,10-/m1/s1.
What are the key properties of (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine?
(1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine has a molecular weight of 155.28 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-butan-2-yl-1,2,2-trimethylcyclopropan-1-amine is sourced from PubChem (CID 155472573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).