C17H16O2 — CID 155473233
2-methyltricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,12,14-pentaene-9,10-dione (PubChem CID 155473233) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-methyltricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,12,14-pentaene-9,10-dione.
| Compound Name | 2-methyltricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,12,14-pentaene-9,10-dione |
|---|---|
| PubChem CID | 155473233 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-methyltricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,12,14-pentaene-9,10-dione |
| SMILES | CC1C2=C(CCC=C2)C(=O)C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C17H16O2/c1-11-13-7-3-2-6-12(13)10-16(18)17(19)15-9-5-4-8-14(11)15/h2-4,6-8,11H,5,9-10H2,1H3 |
| InChIKey | GJLBKVFTWKGWCB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|