About 4-methylidene-1,2-dihydropyridin-3-imine
4-methylidene-1,2-dihydropyridin-3-imine (PubChem CID 155474412) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 4-methylidene-1,2-dihydropyridin-3-imine.
Molecular Properties
| Compound Name | 4-methylidene-1,2-dihydropyridin-3-imine |
| PubChem CID | 155474412 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 4-methylidene-1,2-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\CNC=CC1=C |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-3,7-8H,1,4H2/b7-6+ |
| InChIKey | PVPVBHURWZYCIO-VOTSOKGWSA-N |
| XLogP | 0.68 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidene-1,2-dihydropyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1,2-dihydropyridin-3-imine?
The IUPAC name of 4-methylidene-1,2-dihydropyridin-3-imine (CID 155474412) is 4-methylidene-1,2-dihydropyridin-3-imine.
What is the SMILES notation for 4-methylidene-1,2-dihydropyridin-3-imine?
The canonical SMILES for 4-methylidene-1,2-dihydropyridin-3-imine is [H]/N=C1\CNC=CC1=C.
What is the InChIKey of 4-methylidene-1,2-dihydropyridin-3-imine?
The InChIKey is PVPVBHURWZYCIO-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H8N2/c1-5-2-3-8-4-6(5)7/h2-3,7-8H,1,4H2/b7-6+.
What are the key properties of 4-methylidene-1,2-dihydropyridin-3-imine?
4-methylidene-1,2-dihydropyridin-3-imine has a molecular weight of 108.14 g/mol, XLogP of 0.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1,2-dihydropyridin-3-imine is sourced from PubChem (CID 155474412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).