C28H35F4N3O — CID 155475470
(1R,3R)-1-[2,6-difluoro-4-[1-(2-fluoroethyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indole (PubChem CID 155475470) has the molecular formula C28H35F4N3O and a molecular weight of 505.60 g/mol. Its IUPAC name is (1R,3R)-1-[2,6-difluoro-4-[1-(2-fluoroethyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[2,6-difluoro-4-[1-(2-fluoroethyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155475470 |
| Molecular Formula | C28H35F4N3O |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (1R,3R)-1-[2,6-difluoro-4-[1-(2-fluoroethyl)azetidin-3-yl]oxyphenyl]-2-(2-fluoro-2-methylpropyl)-3,8-dimethyl-1,3,4,8,8a,9-hexahydropyrido[3,4-b]indole |
| SMILES | CC1C=CC=C2C3=C(NC21)[C@@H](c1c(F)cc(OC2CN(CCF)C2)cc1F)N(CC(C)(C)F)[C@H](C)C3 |
| InChI | InChI=1S/C28H35F4N3O/c1-16-6-5-7-20-21-10-17(2)35(15-28(3,4)32)27(26(21)33-25(16)20)24-22(30)11-18(12-23(24)31)36-19-13-34(14-19)9-8-29/h5-7,11-12,16-17,19,25,27,33H,8-10,13-15H2,1-4H3/t16?,17-,25?,27-/m1/s1 |
| InChIKey | VNEZBZCCEXNQIM-MHHBDWJMSA-N |
| XLogP | 5.24 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |