C22H31N3O2 — CID 155475556
1-[3-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]diazenyl]-4-hydroxyphenyl]-4-methyl-2-(propan-2-ylamino)pentan-3-one (PubChem CID 155475556) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[3-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]diazenyl]-4-hydroxyphenyl]-4-methyl-2-(propan-2-ylamino)pentan-3-one.
| Compound Name | 1-[3-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]diazenyl]-4-hydroxyphenyl]-4-methyl-2-(propan-2-ylamino)pentan-3-one |
|---|---|
| PubChem CID | 155475556 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 1-[3-[[(2E,4Z)-hepta-2,4,6-trien-3-yl]diazenyl]-4-hydroxyphenyl]-4-methyl-2-(propan-2-ylamino)pentan-3-one |
| SMILES | C=C/C=C\C(=C/C)\N=N\c1cc(CC(NC(C)C)C(=O)C(C)C)ccc1O |
| InChI | InChI=1S/C22H31N3O2/c1-7-9-10-18(8-2)24-25-19-13-17(11-12-21(19)26)14-20(23-16(5)6)22(27)15(3)4/h7-13,15-16,20,23,26H,1,14H2,2-6H3/b10-9-,18-8+,25-24+ |
| InChIKey | ZYTZVFMAKFXXNN-GREOQQPGSA-N |
| XLogP | 5.26 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|