C16H23F3N2O — CID 155476306
(3S,5S,6R)-3-amino-6-methyl-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one (PubChem CID 155476306) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is (3S,5S,6R)-3-amino-6-methyl-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one.
| Compound Name | (3S,5S,6R)-3-amino-6-methyl-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
|---|---|
| PubChem CID | 155476306 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3S,5S,6R)-3-amino-6-methyl-5-[(3Z,5Z)-5-methylhepta-1,3,5-trien-2-yl]-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| SMILES | C=C(/C=C\C(C)=C/C)[C@@H]1C[C@H](N)C(=O)N(CC(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C16H23F3N2O/c1-5-10(2)6-7-11(3)13-8-14(20)15(22)21(12(13)4)9-16(17,18)19/h5-7,12-14H,3,8-9,20H2,1-2,4H3/b7-6-,10-5-/t12-,13+,14+/m1/s1 |
| InChIKey | UUKHZKVNAAQTJD-MPZHYVPBSA-N |
| XLogP | 3.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|