C47H33N3O — CID 155476689
N-[(1Z,3Z)-1-[6-phenyl-2-(2-spiro[fluorene-9,9'-xanthene]-3'-ylphenyl)pyrimidin-4-yl]penta-1,3-dienyl]methanimine (PubChem CID 155476689) has the molecular formula C47H33N3O and a molecular weight of 655.80 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-[6-phenyl-2-(2-spiro[fluorene-9,9'-xanthene]-3'-ylphenyl)pyrimidin-4-yl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3Z)-1-[6-phenyl-2-(2-spiro[fluorene-9,9'-xanthene]-3'-ylphenyl)pyrimidin-4-yl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 155476689 |
| Molecular Formula | C47H33N3O |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | N-[(1Z,3Z)-1-[6-phenyl-2-(2-spiro[fluorene-9,9'-xanthene]-3'-ylphenyl)pyrimidin-4-yl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C/C)c1cc(-c2ccccc2)nc(-c2ccccc2-c2ccc3c(c2)Oc2ccccc2C32c3ccccc3-c3ccccc32)n1 |
| InChI | InChI=1S/C47H33N3O/c1-3-4-25-41(48-2)43-30-42(31-16-6-5-7-17-31)49-46(50-43)36-21-9-8-18-33(36)32-27-28-40-45(29-32)51-44-26-15-14-24-39(44)47(40)37-22-12-10-19-34(37)35-20-11-13-23-38(35)47/h3-30H,2H2,1H3/b4-3-,41-25- |
| InChIKey | DKHFBVVEVMZXAZ-DROZSHQGSA-N |
| XLogP | 11.56 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|