C18H17ClFN5O — CID 155476798
N-[3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]pyridine-2-carboxamide (PubChem CID 155476798) has the molecular formula C18H17ClFN5O and a molecular weight of 373.82 g/mol. Its IUPAC name is N-[3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155476798 |
| Molecular Formula | C18H17ClFN5O |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]pyridine-2-carboxamide |
| SMILES | N#Cc1cc(F)c(NC2CCCC(NC(=O)c3ccccn3)C2)nc1Cl |
| InChI | InChI=1S/C18H17ClFN5O/c19-16-11(10-21)8-14(20)17(25-16)23-12-4-3-5-13(9-12)24-18(26)15-6-1-2-7-22-15/h1-2,6-8,12-13H,3-5,9H2,(H,23,25)(H,24,26) |
| InChIKey | WLKYNOYBLCDVGX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|