About (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline
(5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline (PubChem CID 155477207) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline.
Molecular Properties
| Compound Name | (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline |
| PubChem CID | 155477207 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline |
| SMILES | C/C=c1\c(=C/C)c2nc(C)cnc2c2ccccc12 |
| InChI | InChI=1S/C17H16N2/c1-4-12-13(5-2)17-16(18-10-11(3)19-17)15-9-7-6-8-14(12)15/h4-10H,1-3H3/b12-4+,13-5+ |
| InChIKey | XMFYAWRXWRDDQK-QGVJZHQLSA-N |
| XLogP | 2.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline?
The IUPAC name of (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline (CID 155477207) is (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline.
What is the SMILES notation for (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline?
The canonical SMILES for (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline is C/C=c1\c(=C/C)c2nc(C)cnc2c2ccccc12.
What is the InChIKey of (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline?
The InChIKey is XMFYAWRXWRDDQK-QGVJZHQLSA-N. The full InChI is InChI=1S/C17H16N2/c1-4-12-13(5-2)17-16(18-10-11(3)19-17)15-9-7-6-8-14(12)15/h4-10H,1-3H3/b12-4+,13-5+.
What are the key properties of (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline?
(5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline has a molecular weight of 248.33 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6Z)-5,6-di(ethylidene)-3-methylbenzo[f]quinoxaline is sourced from PubChem (CID 155477207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).