C18H29N3 — CID 155477972
(3E,5E,8E)-5-[(Z)-5-imino-2,3-dimethylpent-3-en-2-yl]-1-methyliminodeca-3,5,8-trien-3-amine (PubChem CID 155477972) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is (3E,5E,8E)-5-[(Z)-5-imino-2,3-dimethylpent-3-en-2-yl]-1-methyliminodeca-3,5,8-trien-3-amine.
| Compound Name | (3E,5E,8E)-5-[(Z)-5-imino-2,3-dimethylpent-3-en-2-yl]-1-methyliminodeca-3,5,8-trien-3-amine |
|---|---|
| PubChem CID | 155477972 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | (3E,5E,8E)-5-[(Z)-5-imino-2,3-dimethylpent-3-en-2-yl]-1-methyliminodeca-3,5,8-trien-3-amine |
| SMILES | [H]/N=C/C=C(/C)C(C)(C)C(/C=C(/N)C/C=N/C)=C/C/C=C/C |
| InChI | InChI=1S/C18H29N3/c1-6-7-8-9-16(14-17(20)11-13-21-5)18(3,4)15(2)10-12-19/h6-7,9-10,12-14,19H,8,11,20H2,1-5H3/b7-6+,15-10-,16-9+,17-14+,19-12+,21-13+ |
| InChIKey | AOXPVWGPUJEJPX-UFRXNOKDSA-N |
| XLogP | 4.43 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|