C14H26O2Si2 — CID 15547914
[(3aS,6aS)-5-trimethylsilyloxy-1,3a,4,6a-tetrahydropentalen-2-yl]oxy-trimethylsilane (PubChem CID 15547914) has the molecular formula C14H26O2Si2 and a molecular weight of 282.53 g/mol. Its IUPAC name is [(3aS,6aS)-5-trimethylsilyloxy-1,3a,4,6a-tetrahydropentalen-2-yl]oxy-trimethylsilane.
| Compound Name | [(3aS,6aS)-5-trimethylsilyloxy-1,3a,4,6a-tetrahydropentalen-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15547914 |
| Molecular Formula | C14H26O2Si2 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [(3aS,6aS)-5-trimethylsilyloxy-1,3a,4,6a-tetrahydropentalen-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1=C[C@H]2CC(O[Si](C)(C)C)=C[C@H]2C1 |
| InChI | InChI=1S/C14H26O2Si2/c1-17(2,3)15-13-7-11-9-14(10-12(11)8-13)16-18(4,5)6/h7,10-12H,8-9H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | WJWJAIKPNXNXGT-NWDGAFQWSA-N |
| XLogP | 4.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|