About 5-methoxy-2,3-dihydro-1H-indol-6-ol
5-methoxy-2,3-dihydro-1H-indol-6-ol (PubChem CID 15547921) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydro-1H-indol-6-ol.
Molecular Properties
| Compound Name | 5-methoxy-2,3-dihydro-1H-indol-6-ol |
| PubChem CID | 15547921 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 5-methoxy-2,3-dihydro-1H-indol-6-ol |
| SMILES | COc1cc2c(cc1O)NCC2 |
| InChI | InChI=1S/C9H11NO2/c1-12-9-4-6-2-3-10-7(6)5-8(9)11/h4-5,10-11H,2-3H2,1H3 |
| InChIKey | WJNJOMLKWQNVTH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,3-dihydro-1H-indol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,3-dihydro-1H-indol-6-ol?
The IUPAC name of 5-methoxy-2,3-dihydro-1H-indol-6-ol (CID 15547921) is 5-methoxy-2,3-dihydro-1H-indol-6-ol.
What is the SMILES notation for 5-methoxy-2,3-dihydro-1H-indol-6-ol?
The canonical SMILES for 5-methoxy-2,3-dihydro-1H-indol-6-ol is COc1cc2c(cc1O)NCC2.
What is the InChIKey of 5-methoxy-2,3-dihydro-1H-indol-6-ol?
The InChIKey is WJNJOMLKWQNVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-12-9-4-6-2-3-10-7(6)5-8(9)11/h4-5,10-11H,2-3H2,1H3.
What are the key properties of 5-methoxy-2,3-dihydro-1H-indol-6-ol?
5-methoxy-2,3-dihydro-1H-indol-6-ol has a molecular weight of 165.19 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,3-dihydro-1H-indol-6-ol is sourced from PubChem (CID 15547921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).