C23H27F3N4O3 — CID 155479329
N-but-3-enyl-2-[6-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-5-(1,3-dioxolan-2-yl)-2-methylpyrimidin-4-yl]acetamide (PubChem CID 155479329) has the molecular formula C23H27F3N4O3 and a molecular weight of 464.49 g/mol. Its IUPAC name is N-but-3-enyl-2-[6-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-5-(1,3-dioxolan-2-yl)-2-methylpyrimidin-4-yl]acetamide.
| Compound Name | N-but-3-enyl-2-[6-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-5-(1,3-dioxolan-2-yl)-2-methylpyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 155479329 |
| Molecular Formula | C23H27F3N4O3 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-but-3-enyl-2-[6-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-5-(1,3-dioxolan-2-yl)-2-methylpyrimidin-4-yl]acetamide |
| SMILES | C=CCCNC(=O)Cc1nc(C)nc(N[C@H](C)c2cccc(C(F)F)c2F)c1C1OCCO1 |
| InChI | InChI=1S/C23H27F3N4O3/c1-4-5-9-27-18(31)12-17-19(23-32-10-11-33-23)22(30-14(3)29-17)28-13(2)15-7-6-8-16(20(15)24)21(25)26/h4,6-8,13,21,23H,1,5,9-12H2,2-3H3,(H,27,31)(H,28,29,30)/t13-/m1/s1 |
| InChIKey | LNJNJFLBKFVPEJ-CYBMUJFWSA-N |
| XLogP | 4.32 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|