C16H18N2O3 — CID 155480149
5-methyl-2-[(3S)-1-methyl-2-oxo-4,5-dihydro-3H-azepin-3-yl]-4,5-dihydroisoindole-1,3-dione (PubChem CID 155480149) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 5-methyl-2-[(3S)-1-methyl-2-oxo-4,5-dihydro-3H-azepin-3-yl]-4,5-dihydroisoindole-1,3-dione.
| Compound Name | 5-methyl-2-[(3S)-1-methyl-2-oxo-4,5-dihydro-3H-azepin-3-yl]-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 155480149 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-methyl-2-[(3S)-1-methyl-2-oxo-4,5-dihydro-3H-azepin-3-yl]-4,5-dihydroisoindole-1,3-dione |
| SMILES | CC1C=CC2=C(C1)C(=O)N([C@H]1CCC=CN(C)C1=O)C2=O |
| InChI | InChI=1S/C16H18N2O3/c1-10-6-7-11-12(9-10)15(20)18(14(11)19)13-5-3-4-8-17(2)16(13)21/h4,6-8,10,13H,3,5,9H2,1-2H3/t10?,13-/m0/s1 |
| InChIKey | BSHMIVIRGMHOJA-HQVZTVAUSA-N |
| XLogP | 1.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|