C19H25N7O2 — CID 155480811
1-[(3-ethylcyclobutyl)methyl]-N-[(4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide (PubChem CID 155480811) has the molecular formula C19H25N7O2 and a molecular weight of 383.46 g/mol. Its IUPAC name is 1-[(3-ethylcyclobutyl)methyl]-N-[(4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3-ethylcyclobutyl)methyl]-N-[(4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155480811 |
| Molecular Formula | C19H25N7O2 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-[(3-ethylcyclobutyl)methyl]-N-[(4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl)methylidene]-1,2,4-triazole-3-carboxamide |
| SMILES | CCC1CC(Cn2cnc(C(=O)/N=C/C3CCn4nccc4N(C)C3=O)n2)C1 |
| InChI | InChI=1S/C19H25N7O2/c1-3-13-8-14(9-13)11-25-12-21-17(23-25)18(27)20-10-15-5-7-26-16(4-6-22-26)24(2)19(15)28/h4,6,10,12-15H,3,5,7-9,11H2,1-2H3/b20-10+ |
| InChIKey | HWPPWJSKROQQMN-KEBDBYFISA-N |
| XLogP | 1.80 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|