C22H23F2N3O4 — CID 155480860
(5Z)-N-[(3S)-6,8-difluoro-4-hydroxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-yl]spiro[4,7-dihydro-3H-furo[3,4-b]azocine-9,1'-cyclobutane]-2-carboxamide (PubChem CID 155480860) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is (5Z)-N-[(3S)-6,8-difluoro-4-hydroxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-yl]spiro[4,7-dihydro-3H-furo[3,4-b]azocine-9,1'-cyclobutane]-2-carboxamide.
| Compound Name | (5Z)-N-[(3S)-6,8-difluoro-4-hydroxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-yl]spiro[4,7-dihydro-3H-furo[3,4-b]azocine-9,1'-cyclobutane]-2-carboxamide |
|---|---|
| PubChem CID | 155480860 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (5Z)-N-[(3S)-6,8-difluoro-4-hydroxy-2,3,4,5-tetrahydro-1,5-benzoxazepin-3-yl]spiro[4,7-dihydro-3H-furo[3,4-b]azocine-9,1'-cyclobutane]-2-carboxamide |
| SMILES | O=C(N[C@H]1COc2cc(F)cc(F)c2NC1O)/C1=N/C2=C(/C=C\CC1)COC21CCC1 |
| InChI | InChI=1S/C22H23F2N3O4/c23-13-8-14(24)18-17(9-13)30-11-16(21(29)27-18)26-20(28)15-5-2-1-4-12-10-31-22(6-3-7-22)19(12)25-15/h1,4,8-9,16,21,27,29H,2-3,5-7,10-11H2,(H,26,28)/b4-1-,25-15+/t16-,21?/m0/s1 |
| InChIKey | BHOVUCQAPSZKID-JOHWKIAHSA-N |
| XLogP | 2.57 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |