C27H29NO7 — CID 155480967
(E)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-phenylprop-2-enamide (PubChem CID 155480967) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is (E)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 155480967 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (E)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]-3-phenylprop-2-enamide |
| SMILES | CO[C@@H]1CC[C@H](Oc2ccc3c(O)c(NC(=O)/C=C/c4ccccc4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C27H29NO7/c1-16-19(33-22-15-13-20(32-4)27(2,3)35-22)12-11-18-24(30)23(26(31)34-25(16)18)28-21(29)14-10-17-8-6-5-7-9-17/h5-12,14,20,22,30H,13,15H2,1-4H3,(H,28,29)/b14-10+/t20-,22-/m1/s1 |
| InChIKey | KOTZUHRKJAZURV-LHENUYEISA-N |
| XLogP | 4.77 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|