C31H30FNO7 — CID 155481248
3-(4-fluorophenyl)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide (PubChem CID 155481248) has the molecular formula C31H30FNO7 and a molecular weight of 547.58 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide.
| Compound Name | 3-(4-fluorophenyl)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide |
|---|---|
| PubChem CID | 155481248 |
| Molecular Formula | C31H30FNO7 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[4-hydroxy-7-[(2R,5R)-5-methoxy-6,6-dimethyloxan-2-yl]oxy-8-methyl-2-oxochromen-3-yl]benzamide |
| SMILES | COC1CC[C@H](Oc2ccc3c(O)c(NC(=O)c4cccc(-c5ccc(F)cc5)c4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C31H30FNO7/c1-17-23(38-25-15-14-24(37-4)31(2,3)40-25)13-12-22-27(34)26(30(36)39-28(17)22)33-29(35)20-7-5-6-19(16-20)18-8-10-21(32)11-9-18/h5-13,16,24-25,34H,14-15H2,1-4H3,(H,33,35)/t24?,25-/m1/s1 |
| InChIKey | KGJMXBGDWOWLFC-WUBHUQEYSA-N |
| XLogP | 6.17 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|