C16H15Br2NO4 — CID 155481618
4,12-dibromo-8-hexyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione (PubChem CID 155481618) has the molecular formula C16H15Br2NO4 and a molecular weight of 445.11 g/mol. Its IUPAC name is 4,12-dibromo-8-hexyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione.
| Compound Name | 4,12-dibromo-8-hexyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione |
|---|---|
| PubChem CID | 155481618 |
| Molecular Formula | C16H15Br2NO4 |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 4,12-dibromo-8-hexyl-3,13-dioxa-8-azatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-7,9-dione |
| SMILES | CCCCCCn1c(=O)c2cc(Br)oc2c2oc(Br)cc2c1=O |
| InChI | InChI=1S/C16H15Br2NO4/c1-2-3-4-5-6-19-15(20)9-7-11(17)22-13(9)14-10(16(19)21)8-12(18)23-14/h7-8H,2-6H2,1H3 |
| InChIKey | YGNYPGVMEAEZOV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 65.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|