About 3-methyl-2,7-dimethylidene-1H-azonine
3-methyl-2,7-dimethylidene-1H-azonine (PubChem CID 155481641) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-methyl-2,7-dimethylidene-1H-azonine.
Molecular Properties
| Compound Name | 3-methyl-2,7-dimethylidene-1H-azonine |
| PubChem CID | 155481641 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3-methyl-2,7-dimethylidene-1H-azonine |
| SMILES | C=c1cccc(C)c(=C)[nH]cc1 |
| InChI | InChI=1S/C11H13N/c1-9-5-4-6-10(2)11(3)12-8-7-9/h4-8,12H,1,3H2,2H3/b5-4-,8-7-,10-6- |
| InChIKey | HCDLRBRGBXNNSL-GSIBVPERSA-N |
| XLogP | 1.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-2,7-dimethylidene-1H-azonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,7-dimethylidene-1H-azonine?
The IUPAC name of 3-methyl-2,7-dimethylidene-1H-azonine (CID 155481641) is 3-methyl-2,7-dimethylidene-1H-azonine.
What is the SMILES notation for 3-methyl-2,7-dimethylidene-1H-azonine?
The canonical SMILES for 3-methyl-2,7-dimethylidene-1H-azonine is C=c1cccc(C)c(=C)[nH]cc1.
What is the InChIKey of 3-methyl-2,7-dimethylidene-1H-azonine?
The InChIKey is HCDLRBRGBXNNSL-GSIBVPERSA-N. The full InChI is InChI=1S/C11H13N/c1-9-5-4-6-10(2)11(3)12-8-7-9/h4-8,12H,1,3H2,2H3/b5-4-,8-7-,10-6-.
What are the key properties of 3-methyl-2,7-dimethylidene-1H-azonine?
3-methyl-2,7-dimethylidene-1H-azonine has a molecular weight of 159.23 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,7-dimethylidene-1H-azonine is sourced from PubChem (CID 155481641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).