C22H17N5O2 — CID 155481975
5-cyano-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide (PubChem CID 155481975) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 5-cyano-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 155481975 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-cyano-N-[3-(4-methoxyphenyl)-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
| SMILES | COc1ccc(-c2n[nH]c3ccc(NC(=O)c4ncc(C#N)cc4C)cc23)cc1 |
| InChI | InChI=1S/C22H17N5O2/c1-13-9-14(11-23)12-24-20(13)22(28)25-16-5-8-19-18(10-16)21(27-26-19)15-3-6-17(29-2)7-4-15/h3-10,12H,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | CCAQHZUWTHJDIW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |