About 5-bromo-2-ethenyl-3,6-dimethylpyridine
5-bromo-2-ethenyl-3,6-dimethylpyridine (PubChem CID 155482008) has the molecular formula C9H10BrN
and a molecular weight of 212.09 g/mol. Its IUPAC name is 5-bromo-2-ethenyl-3,6-dimethylpyridine.
Molecular Properties
| Compound Name | 5-bromo-2-ethenyl-3,6-dimethylpyridine |
| PubChem CID | 155482008 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5-bromo-2-ethenyl-3,6-dimethylpyridine |
| SMILES | C=Cc1nc(C)c(Br)cc1C |
| InChI | InChI=1S/C9H10BrN/c1-4-9-6(2)5-8(10)7(3)11-9/h4-5H,1H2,2-3H3 |
| InChIKey | BRLNLUQQMFRCTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2-ethenyl-3,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-ethenyl-3,6-dimethylpyridine?
The IUPAC name of 5-bromo-2-ethenyl-3,6-dimethylpyridine (CID 155482008) is 5-bromo-2-ethenyl-3,6-dimethylpyridine.
What is the SMILES notation for 5-bromo-2-ethenyl-3,6-dimethylpyridine?
The canonical SMILES for 5-bromo-2-ethenyl-3,6-dimethylpyridine is C=Cc1nc(C)c(Br)cc1C.
What is the InChIKey of 5-bromo-2-ethenyl-3,6-dimethylpyridine?
The InChIKey is BRLNLUQQMFRCTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN/c1-4-9-6(2)5-8(10)7(3)11-9/h4-5H,1H2,2-3H3.
What are the key properties of 5-bromo-2-ethenyl-3,6-dimethylpyridine?
5-bromo-2-ethenyl-3,6-dimethylpyridine has a molecular weight of 212.09 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-ethenyl-3,6-dimethylpyridine is sourced from PubChem (CID 155482008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).