About 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid
4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid (PubChem CID 155483631) has the molecular formula C13H25NO5
and a molecular weight of 275.34 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid |
| PubChem CID | 155483631 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid |
| SMILES | COC(C)C(C(=O)O)C(C)(C)C(=O)OCCN(C)C |
| InChI | InChI=1S/C13H25NO5/c1-9(18-6)10(11(15)16)13(2,3)12(17)19-8-7-14(4)5/h9-10H,7-8H2,1-6H3,(H,15,16) |
| InChIKey | AEZCQQJJFIMHBH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid (CID 155483631) is 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid is COC(C)C(C(=O)O)C(C)(C)C(=O)OCCN(C)C.
What is the InChIKey of 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid?
The InChIKey is AEZCQQJJFIMHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO5/c1-9(18-6)10(11(15)16)13(2,3)12(17)19-8-7-14(4)5/h9-10H,7-8H2,1-6H3,(H,15,16).
What are the key properties of 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid?
4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid has a molecular weight of 275.34 g/mol, XLogP of 0.85, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(dimethylamino)ethoxy]-2-(1-methoxyethyl)-3,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 155483631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).